C28H30O6 — CID 142194126
methyl 3-[4-[3-(4-benzoylphenoxy)propoxy]-3-ethylphenyl]-2-hydroxypropanoate (PubChem CID 142194126) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-benzoylphenoxy)propoxy]-3-ethylphenyl]-2-hydroxypropanoate.
| Compound Name | methyl 3-[4-[3-(4-benzoylphenoxy)propoxy]-3-ethylphenyl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 142194126 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | methyl 3-[4-[3-(4-benzoylphenoxy)propoxy]-3-ethylphenyl]-2-hydroxypropanoate |
| SMILES | CCc1cc(CC(O)C(=O)OC)ccc1OCCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30O6/c1-3-21-18-20(19-25(29)28(31)32-2)10-15-26(21)34-17-7-16-33-24-13-11-23(12-14-24)27(30)22-8-5-4-6-9-22/h4-6,8-15,18,25,29H,3,7,16-17,19H2,1-2H3 |
| InChIKey | STJXRMBJDAATLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|