C27H30O6 — CID 142194138
ethyl 2-hydroxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoate (PubChem CID 142194138) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoate.
| Compound Name | ethyl 2-hydroxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 142194138 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | ethyl 2-hydroxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(O)Cc1ccc(OCCCOc2ccc(-c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H30O6/c1-3-31-27(29)24(28)18-20-10-15-25(26(19-20)30-2)33-17-7-16-32-23-13-11-22(12-14-23)21-8-5-4-6-9-21/h4-6,8-15,19,24,28H,3,7,16-18H2,1-2H3 |
| InChIKey | YKEYVOQZZVKOMU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|