C26H28O6 — CID 91601490
3-methoxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid (PubChem CID 91601490) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 3-methoxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid.
| Compound Name | 3-methoxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91601490 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-methoxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)OC)ccc1OCCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O6/c1-29-24(18-26(27)28)21-11-14-23(25(17-21)30-2)32-16-6-15-31-22-12-9-20(10-13-22)19-7-4-3-5-8-19/h3-5,7-14,17,24H,6,15-16,18H2,1-2H3,(H,27,28) |
| InChIKey | GUTXZXXQDVFZOA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|