C30H28O6 — CID 142194230
(2S)-2-hydroxy-3-[3-(2-hydroxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid (PubChem CID 142194230) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[3-(2-hydroxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[3-(2-hydroxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142194230 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (2S)-2-hydroxy-3-[3-(2-hydroxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid |
| SMILES | O=C(O)[C@@H](O)Cc1ccc(OCCCOc2ccc(-c3ccccc3)cc2)c(-c2ccccc2O)c1 |
| InChI | InChI=1S/C30H28O6/c31-27-10-5-4-9-25(27)26-19-21(20-28(32)30(33)34)11-16-29(26)36-18-6-17-35-24-14-12-23(13-15-24)22-7-2-1-3-8-22/h1-5,7-16,19,28,31-32H,6,17-18,20H2,(H,33,34)/t28-/m0/s1 |
| InChIKey | GVYUOMJEVABKNM-NDEPHWFRSA-N |
| XLogP | 5.56 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|