C31H35O5P — CID 142194023
ethane;3-[4-ethoxy-3-(4-phosphanylphenyl)phenyl]-2-hydroxypropanoic acid;4-phenylphenol (PubChem CID 142194023) has the molecular formula C31H35O5P and a molecular weight of 518.59 g/mol. Its IUPAC name is ethane;3-[4-ethoxy-3-(4-phosphanylphenyl)phenyl]-2-hydroxypropanoic acid;4-phenylphenol.
| Compound Name | ethane;3-[4-ethoxy-3-(4-phosphanylphenyl)phenyl]-2-hydroxypropanoic acid;4-phenylphenol |
|---|---|
| PubChem CID | 142194023 |
| Molecular Formula | C31H35O5P |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | ethane;3-[4-ethoxy-3-(4-phosphanylphenyl)phenyl]-2-hydroxypropanoic acid;4-phenylphenol |
| SMILES | CC.CCOc1ccc(CC(O)C(=O)O)cc1-c1ccc(P)cc1.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19O4P.C12H10O.C2H6/c1-2-21-16-8-3-11(10-15(18)17(19)20)9-14(16)12-4-6-13(22)7-5-12;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2/h3-9,15,18H,2,10,22H2,1H3,(H,19,20);1-9,13H;1-2H3 |
| InChIKey | SAJFCOYECREBJR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|