About 4-(2-ethoxyphenyl)phenol
4-(2-ethoxyphenyl)phenol (PubChem CID 83129672) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)phenol.
Molecular Properties
| Compound Name | 4-(2-ethoxyphenyl)phenol |
| PubChem CID | 83129672 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 4-(2-ethoxyphenyl)phenol |
| SMILES | CCOc1ccccc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14O2/c1-2-16-14-6-4-3-5-13(14)11-7-9-12(15)10-8-11/h3-10,15H,2H2,1H3 |
| InChIKey | UKPPMQSPVBBFCL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-ethoxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxyphenyl)phenol?
The IUPAC name of 4-(2-ethoxyphenyl)phenol (CID 83129672) is 4-(2-ethoxyphenyl)phenol.
What is the SMILES notation for 4-(2-ethoxyphenyl)phenol?
The canonical SMILES for 4-(2-ethoxyphenyl)phenol is CCOc1ccccc1-c1ccc(O)cc1.
What is the InChIKey of 4-(2-ethoxyphenyl)phenol?
The InChIKey is UKPPMQSPVBBFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-2-16-14-6-4-3-5-13(14)11-7-9-12(15)10-8-11/h3-10,15H,2H2,1H3.
What are the key properties of 4-(2-ethoxyphenyl)phenol?
4-(2-ethoxyphenyl)phenol has a molecular weight of 214.26 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxyphenyl)phenol is sourced from PubChem (CID 83129672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).