C29H34O6 — CID 22458910
methyl 2-[3-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]acetate (PubChem CID 22458910) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is methyl 2-[3-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]acetate |
|---|---|
| PubChem CID | 22458910 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | methyl 2-[3-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]acetate |
| SMILES | CCCc1cc(Oc2ccc(OC)cc2)ccc1OCCCCOc1cccc(CC(=O)OC)c1 |
| InChI | InChI=1S/C29H34O6/c1-4-8-23-21-27(35-25-13-11-24(31-2)12-14-25)15-16-28(23)34-18-6-5-17-33-26-10-7-9-22(19-26)20-29(30)32-3/h7,9-16,19,21H,4-6,8,17-18,20H2,1-3H3 |
| InChIKey | LDFHYSULPPOGDJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|