C29H31NO6S — CID 22458986
5-[4-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22458986) has the molecular formula C29H31NO6S and a molecular weight of 521.64 g/mol. Its IUPAC name is 5-[4-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22458986 |
| Molecular Formula | C29H31NO6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 5-[4-[4-[4-(4-methoxyphenoxy)-2-propylphenoxy]butoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(Oc2ccc(OC)cc2)ccc1OCCCCOc1ccc(C2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C29H31NO6S/c1-3-6-21-19-25(36-24-13-11-22(33-2)12-14-24)15-16-26(21)35-18-5-4-17-34-23-9-7-20(8-10-23)27-28(31)30-29(32)37-27/h7-16,19,27H,3-6,17-18H2,1-2H3,(H,30,31,32) |
| InChIKey | BXLPZSJJIZWMHZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|