C33H38N2O5S — CID 59945822
5-[4-[3-[4-[(Z)-N-methoxy-C-(2-methyl-2-phenylpropyl)carbonimidoyl]-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 59945822) has the molecular formula C33H38N2O5S and a molecular weight of 574.74 g/mol. Its IUPAC name is 5-[4-[3-[4-[(Z)-N-methoxy-C-(2-methyl-2-phenylpropyl)carbonimidoyl]-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[3-[4-[(Z)-N-methoxy-C-(2-methyl-2-phenylpropyl)carbonimidoyl]-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59945822 |
| Molecular Formula | C33H38N2O5S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 5-[4-[3-[4-[(Z)-N-methoxy-C-(2-methyl-2-phenylpropyl)carbonimidoyl]-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(/C(CC(C)(C)c2ccccc2)=N\OC)ccc1OCCCOc1ccc(C2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C33H38N2O5S/c1-5-10-25-21-24(28(35-38-4)22-33(2,3)26-11-7-6-8-12-26)15-18-29(25)40-20-9-19-39-27-16-13-23(14-17-27)30-31(36)34-32(37)41-30/h6-8,11-18,21,30H,5,9-10,19-20,22H2,1-4H3,(H,34,36,37)/b35-28- |
| InChIKey | ISBPMAUHZMSDQJ-NUDFZHEQSA-N |
| XLogP | 7.23 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|