C15H19NO3S — CID 142938425
(5S)-5-[(2-pentoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 142938425) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (5S)-5-[(2-pentoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2-pentoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142938425 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (5S)-5-[(2-pentoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCOc1ccccc1C[C@@H]1SC(=O)NC1=O |
| InChI | InChI=1S/C15H19NO3S/c1-2-3-6-9-19-12-8-5-4-7-11(12)10-13-14(17)16-15(18)20-13/h4-5,7-8,13H,2-3,6,9-10H2,1H3,(H,16,17,18)/t13-/m0/s1 |
| InChIKey | UQMHUDJPGZEYFE-ZDUSSCGKSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|