C32H35NO5S — CID 91932576
5-[4-[3-[4-(4-cyclopentylphenoxy)-2-propylphenoxy]propoxy]phenyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 91932576) has the molecular formula C32H35NO5S and a molecular weight of 545.70 g/mol. Its IUPAC name is 5-[4-[3-[4-(4-cyclopentylphenoxy)-2-propylphenoxy]propoxy]phenyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[4-[3-[4-(4-cyclopentylphenoxy)-2-propylphenoxy]propoxy]phenyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91932576 |
| Molecular Formula | C32H35NO5S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 5-[4-[3-[4-(4-cyclopentylphenoxy)-2-propylphenoxy]propoxy]phenyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | CCCc1cc(Oc2ccc(C3CCCC3)cc2)ccc1OCCCOc1ccc(-c2sc(=O)[nH]c2O)cc1 |
| InChI | InChI=1S/C32H35NO5S/c1-2-6-25-21-28(38-27-15-9-23(10-16-27)22-7-3-4-8-22)17-18-29(25)37-20-5-19-36-26-13-11-24(12-14-26)30-31(34)33-32(35)39-30/h9-18,21-22,34H,2-8,19-20H2,1H3,(H,33,35) |
| InChIKey | XLFIMPFGRCWOPJ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|