C24H28Br2O2 — CID 21466321
4-(4-cyclohexylphenoxy)-1-(3,3-dibromoprop-2-enoxy)-2-propylbenzene (PubChem CID 21466321) has the molecular formula C24H28Br2O2 and a molecular weight of 508.29 g/mol. Its IUPAC name is 4-(4-cyclohexylphenoxy)-1-(3,3-dibromoprop-2-enoxy)-2-propylbenzene.
| Compound Name | 4-(4-cyclohexylphenoxy)-1-(3,3-dibromoprop-2-enoxy)-2-propylbenzene |
|---|---|
| PubChem CID | 21466321 |
| Molecular Formula | C24H28Br2O2 |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 4-(4-cyclohexylphenoxy)-1-(3,3-dibromoprop-2-enoxy)-2-propylbenzene |
| SMILES | CCCc1cc(Oc2ccc(C3CCCCC3)cc2)ccc1OCC=C(Br)Br |
| InChI | InChI=1S/C24H28Br2O2/c1-2-6-20-17-22(13-14-23(20)27-16-15-24(25)26)28-21-11-9-19(10-12-21)18-7-4-3-5-8-18/h9-15,17-18H,2-8,16H2,1H3 |
| InChIKey | CTNKHDIKAOFJCO-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |