C28H30N2O7S2 — CID 91932571
N-[4-[4-[3-[4-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)phenoxy]propoxy]-3-propylphenoxy]phenyl]methanesulfonamide (PubChem CID 91932571) has the molecular formula C28H30N2O7S2 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[4-[4-[3-[4-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)phenoxy]propoxy]-3-propylphenoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[3-[4-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)phenoxy]propoxy]-3-propylphenoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91932571 |
| Molecular Formula | C28H30N2O7S2 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | N-[4-[4-[3-[4-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)phenoxy]propoxy]-3-propylphenoxy]phenyl]methanesulfonamide |
| SMILES | CCCc1cc(Oc2ccc(NS(C)(=O)=O)cc2)ccc1OCCCOc1ccc(-c2sc(=O)[nH]c2O)cc1 |
| InChI | InChI=1S/C28H30N2O7S2/c1-3-5-20-18-24(37-23-12-8-21(9-13-23)30-39(2,33)34)14-15-25(20)36-17-4-16-35-22-10-6-19(7-11-22)26-27(31)29-28(32)38-26/h6-15,18,30-31H,3-5,16-17H2,1-2H3,(H,29,32) |
| InChIKey | VPTAHVMPJGDDSU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|