C28H31NO8S — CID 69353836
[(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]sulfonylazetidin-2-yl] hydrogen carbonate (PubChem CID 69353836) has the molecular formula C28H31NO8S and a molecular weight of 541.62 g/mol. Its IUPAC name is [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]sulfonylazetidin-2-yl] hydrogen carbonate.
| Compound Name | [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]sulfonylazetidin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69353836 |
| Molecular Formula | C28H31NO8S |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]sulfonylazetidin-2-yl] hydrogen carbonate |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCOc1ccc(S(=O)(=O)N2CC[C@H]2OC(=O)O)cc1 |
| InChI | InChI=1S/C28H31NO8S/c1-2-7-21-20-24(36-23-8-4-3-5-9-23)12-15-26(21)35-19-6-18-34-22-10-13-25(14-11-22)38(32,33)29-17-16-27(29)37-28(30)31/h3-5,8-15,20,27H,2,6-7,16-19H2,1H3,(H,30,31)/t27-/m1/s1 |
| InChIKey | RKLVJHBKGQFVPK-HHHXNRCGSA-N |
| XLogP | 5.69 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|