C35H33NO7S — CID 134465280
benzyl (5R)-2,4-dioxo-5-[3-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-1,3-thiazolidine-5-carboxylate (PubChem CID 134465280) has the molecular formula C35H33NO7S and a molecular weight of 611.72 g/mol. Its IUPAC name is benzyl (5R)-2,4-dioxo-5-[3-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-1,3-thiazolidine-5-carboxylate.
| Compound Name | benzyl (5R)-2,4-dioxo-5-[3-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 134465280 |
| Molecular Formula | C35H33NO7S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | benzyl (5R)-2,4-dioxo-5-[3-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-1,3-thiazolidine-5-carboxylate |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCOc1cccc([C@@]2(C(=O)OCc3ccccc3)SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C35H33NO7S/c1-2-11-26-22-30(43-28-15-7-4-8-16-28)18-19-31(26)41-21-10-20-40-29-17-9-14-27(23-29)35(32(37)36-34(39)44-35)33(38)42-24-25-12-5-3-6-13-25/h3-9,12-19,22-23H,2,10-11,20-21,24H2,1H3,(H,36,37,39)/t35-/m1/s1 |
| InChIKey | FOJYOVGAQDJPJI-PGUFJCEWSA-N |
| XLogP | 7.20 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|