C28H28FNO5S — CID 22459167
5-[3-[3-[4-(4-fluorophenoxy)-2-propylphenoxy]propoxy]phenyl]-5-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 22459167) has the molecular formula C28H28FNO5S and a molecular weight of 509.60 g/mol. Its IUPAC name is 5-[3-[3-[4-(4-fluorophenoxy)-2-propylphenoxy]propoxy]phenyl]-5-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[3-[3-[4-(4-fluorophenoxy)-2-propylphenoxy]propoxy]phenyl]-5-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22459167 |
| Molecular Formula | C28H28FNO5S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 5-[3-[3-[4-(4-fluorophenoxy)-2-propylphenoxy]propoxy]phenyl]-5-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(Oc2ccc(F)cc2)ccc1OCCCOc1cccc(C2(C)SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C28H28FNO5S/c1-3-6-19-17-24(35-22-11-9-21(29)10-12-22)13-14-25(19)34-16-5-15-33-23-8-4-7-20(18-23)28(2)26(31)30-27(32)36-28/h4,7-14,17-18H,3,5-6,15-16H2,1-2H3,(H,30,31,32) |
| InChIKey | DPLOMJVPBLXOFV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|