C40H38O8 — CID 139784058
3,4-bis[4-(3-phenoxyphenyl)butoxy]phthalic acid (PubChem CID 139784058) has the molecular formula C40H38O8 and a molecular weight of 646.74 g/mol. Its IUPAC name is 3,4-bis[4-(3-phenoxyphenyl)butoxy]phthalic acid.
| Compound Name | 3,4-bis[4-(3-phenoxyphenyl)butoxy]phthalic acid |
|---|---|
| PubChem CID | 139784058 |
| Molecular Formula | C40H38O8 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 3,4-bis[4-(3-phenoxyphenyl)butoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(OCCCCc2cccc(Oc3ccccc3)c2)c(OCCCCc2cccc(Oc3ccccc3)c2)c1C(=O)O |
| InChI | InChI=1S/C40H38O8/c41-39(42)35-23-24-36(45-25-9-7-13-29-15-11-21-33(27-29)47-31-17-3-1-4-18-31)38(37(35)40(43)44)46-26-10-8-14-30-16-12-22-34(28-30)48-32-19-5-2-6-20-32/h1-6,11-12,15-24,27-28H,7-10,13-14,25-26H2,(H,41,42)(H,43,44) |
| InChIKey | UFHQKOJEKZWOQM-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|