C34H30O6 — CID 139783987
3,4-bis(3-naphthalen-2-ylpropoxy)phthalic acid (PubChem CID 139783987) has the molecular formula C34H30O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is 3,4-bis(3-naphthalen-2-ylpropoxy)phthalic acid.
| Compound Name | 3,4-bis(3-naphthalen-2-ylpropoxy)phthalic acid |
|---|---|
| PubChem CID | 139783987 |
| Molecular Formula | C34H30O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 3,4-bis(3-naphthalen-2-ylpropoxy)phthalic acid |
| SMILES | O=C(O)c1ccc(OCCCc2ccc3ccccc3c2)c(OCCCc2ccc3ccccc3c2)c1C(=O)O |
| InChI | InChI=1S/C34H30O6/c35-33(36)29-17-18-30(39-19-5-7-23-13-15-25-9-1-3-11-27(25)21-23)32(31(29)34(37)38)40-20-6-8-24-14-16-26-10-2-4-12-28(26)22-24/h1-4,9-18,21-22H,5-8,19-20H2,(H,35,36)(H,37,38) |
| InChIKey | AYEXHWLVLXETHT-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|