C40H36Cl2O8 — CID 139783908
3,4-bis[4-[3-(3-chlorophenoxy)phenyl]butoxy]phthalic acid (PubChem CID 139783908) has the molecular formula C40H36Cl2O8 and a molecular weight of 715.63 g/mol. Its IUPAC name is 3,4-bis[4-[3-(3-chlorophenoxy)phenyl]butoxy]phthalic acid.
| Compound Name | 3,4-bis[4-[3-(3-chlorophenoxy)phenyl]butoxy]phthalic acid |
|---|---|
| PubChem CID | 139783908 |
| Molecular Formula | C40H36Cl2O8 |
| Molecular Weight | 715.63 g/mol |
| Exact Mass | 714.18 |
| IUPAC Name | 3,4-bis[4-[3-(3-chlorophenoxy)phenyl]butoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(OCCCCc2cccc(Oc3cccc(Cl)c3)c2)c(OCCCCc2cccc(Oc3cccc(Cl)c3)c2)c1C(=O)O |
| InChI | InChI=1S/C40H36Cl2O8/c41-29-13-7-17-33(25-29)49-31-15-5-11-27(23-31)9-1-3-21-47-36-20-19-35(39(43)44)37(40(45)46)38(36)48-22-4-2-10-28-12-6-16-32(24-28)50-34-18-8-14-30(42)26-34/h5-8,11-20,23-26H,1-4,9-10,21-22H2,(H,43,44)(H,45,46) |
| InChIKey | OVBQMVKSMJALKI-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.63 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|