C22H22O4 — CID 58521492
4-(3-methoxypropyl)-2-(naphthalen-1-ylmethoxy)benzoic acid (PubChem CID 58521492) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-2-(naphthalen-1-ylmethoxy)benzoic acid.
| Compound Name | 4-(3-methoxypropyl)-2-(naphthalen-1-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 58521492 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(3-methoxypropyl)-2-(naphthalen-1-ylmethoxy)benzoic acid |
| SMILES | COCCCc1ccc(C(=O)O)c(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22O4/c1-25-13-5-6-16-11-12-20(22(23)24)21(14-16)26-15-18-9-4-8-17-7-2-3-10-19(17)18/h2-4,7-12,14H,5-6,13,15H2,1H3,(H,23,24) |
| InChIKey | JKQHVXQWWCNUJZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|