C24H16Cl2O3 — CID 58521508
4-(3,4-dichlorophenyl)-2-(naphthalen-1-ylmethoxy)benzoic acid (PubChem CID 58521508) has the molecular formula C24H16Cl2O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-(naphthalen-1-ylmethoxy)benzoic acid.
| Compound Name | 4-(3,4-dichlorophenyl)-2-(naphthalen-1-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 58521508 |
| Molecular Formula | C24H16Cl2O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-(naphthalen-1-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)c(Cl)c2)cc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H16Cl2O3/c25-21-11-9-16(12-22(21)26)17-8-10-20(24(27)28)23(13-17)29-14-18-6-3-5-15-4-1-2-7-19(15)18/h1-13H,14H2,(H,27,28) |
| InChIKey | RKZUJMYOGRKOBA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |