C26H28O3 — CID 58521522
4-[(4-methylcyclohexyl)methyl]-2-(naphthalen-1-ylmethoxy)benzoic acid (PubChem CID 58521522) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-[(4-methylcyclohexyl)methyl]-2-(naphthalen-1-ylmethoxy)benzoic acid.
| Compound Name | 4-[(4-methylcyclohexyl)methyl]-2-(naphthalen-1-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 58521522 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-[(4-methylcyclohexyl)methyl]-2-(naphthalen-1-ylmethoxy)benzoic acid |
| SMILES | CC1CCC(Cc2ccc(C(=O)O)c(OCc3cccc4ccccc34)c2)CC1 |
| InChI | InChI=1S/C26H28O3/c1-18-9-11-19(12-10-18)15-20-13-14-24(26(27)28)25(16-20)29-17-22-7-4-6-21-5-2-3-8-23(21)22/h2-8,13-14,16,18-19H,9-12,15,17H2,1H3,(H,27,28) |
| InChIKey | CXGLGLNANOTINZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |