C22H22ClNO3 — CID 46202294
2-[(7-chloronaphthalen-1-yl)methoxy]-4-(diethylamino)benzoic acid (PubChem CID 46202294) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-[(7-chloronaphthalen-1-yl)methoxy]-4-(diethylamino)benzoic acid.
| Compound Name | 2-[(7-chloronaphthalen-1-yl)methoxy]-4-(diethylamino)benzoic acid |
|---|---|
| PubChem CID | 46202294 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[(7-chloronaphthalen-1-yl)methoxy]-4-(diethylamino)benzoic acid |
| SMILES | CCN(CC)c1ccc(C(=O)O)c(OCc2cccc3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-3-24(4-2)18-10-11-19(22(25)26)21(13-18)27-14-16-7-5-6-15-8-9-17(23)12-20(15)16/h5-13H,3-4,14H2,1-2H3,(H,25,26) |
| InChIKey | KQUAFUIBOGWORJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |