C29H34N2O8S — CID 66896892
methyl 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate (PubChem CID 66896892) has the molecular formula C29H34N2O8S and a molecular weight of 570.66 g/mol. Its IUPAC name is methyl 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate.
| Compound Name | methyl 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate |
|---|---|
| PubChem CID | 66896892 |
| Molecular Formula | C29H34N2O8S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | methyl 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(Oc3cccc(NC(=O)OC(C)(C)C)c3)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C29H34N2O8S/c1-6-7-17-37-21-11-14-24(15-12-21)40(34,35)31-26-16-13-23(19-25(26)27(32)36-5)38-22-10-8-9-20(18-22)30-28(33)39-29(2,3)4/h8-16,18-19,31H,6-7,17H2,1-5H3,(H,30,33) |
| InChIKey | DEKNMQIPLIIUFB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|