C31H31ClN2O6S — CID 45275833
2-[(4-butoxyphenyl)sulfonylamino]-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid (PubChem CID 45275833) has the molecular formula C31H31ClN2O6S and a molecular weight of 595.12 g/mol. Its IUPAC name is 2-[(4-butoxyphenyl)sulfonylamino]-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid.
| Compound Name | 2-[(4-butoxyphenyl)sulfonylamino]-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 45275833 |
| Molecular Formula | C31H31ClN2O6S |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 2-[(4-butoxyphenyl)sulfonylamino]-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(NCc3cccc(OCc4ccccc4Cl)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H31ClN2O6S/c1-2-3-17-39-25-12-14-27(15-13-25)41(37,38)34-30-16-11-24(19-28(30)31(35)36)33-20-22-7-6-9-26(18-22)40-21-23-8-4-5-10-29(23)32/h4-16,18-19,33-34H,2-3,17,20-21H2,1H3,(H,35,36) |
| InChIKey | PEUJNJPAISTDCK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|