C15H10F2N2O4S — CID 71880894
3-[(3-cyano-4-fluorophenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid (PubChem CID 71880894) has the molecular formula C15H10F2N2O4S and a molecular weight of 352.32 g/mol. Its IUPAC name is 3-[(3-cyano-4-fluorophenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid.
| Compound Name | 3-[(3-cyano-4-fluorophenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 71880894 |
| Molecular Formula | C15H10F2N2O4S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-[(3-cyano-4-fluorophenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1S(=O)(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C15H10F2N2O4S/c1-8-13(17)5-9(15(20)21)6-14(8)24(22,23)19-11-2-3-12(16)10(4-11)7-18/h2-6,19H,1H3,(H,20,21) |
| InChIKey | CWVGTHCPCXFGHK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |