C18H22N2O5S — CID 55551961
3,4-diethoxy-N-[4-(sulfamoylmethyl)phenyl]benzamide (PubChem CID 55551961) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3,4-diethoxy-N-[4-(sulfamoylmethyl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[4-(sulfamoylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55551961 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3,4-diethoxy-N-[4-(sulfamoylmethyl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(CS(N)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C18H22N2O5S/c1-3-24-16-10-7-14(11-17(16)25-4-2)18(21)20-15-8-5-13(6-9-15)12-26(19,22)23/h5-11H,3-4,12H2,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | JQXNAANNOZRKSP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |