C14H23NO4S — CID 63191159
3,4-diethoxy-N-(3-methylsulfonylpropyl)aniline (PubChem CID 63191159) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 3,4-diethoxy-N-(3-methylsulfonylpropyl)aniline.
| Compound Name | 3,4-diethoxy-N-(3-methylsulfonylpropyl)aniline |
|---|---|
| PubChem CID | 63191159 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3,4-diethoxy-N-(3-methylsulfonylpropyl)aniline |
| SMILES | CCOc1ccc(NCCCS(C)(=O)=O)cc1OCC |
| InChI | InChI=1S/C14H23NO4S/c1-4-18-13-8-7-12(11-14(13)19-5-2)15-9-6-10-20(3,16)17/h7-8,11,15H,4-6,9-10H2,1-3H3 |
| InChIKey | QDAAGFORNDEARB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|