C11H18N2O3S — CID 63671672
2-ethoxy-4-N-(2-methylsulfonylethyl)benzene-1,4-diamine (PubChem CID 63671672) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-ethoxy-4-N-(2-methylsulfonylethyl)benzene-1,4-diamine.
| Compound Name | 2-ethoxy-4-N-(2-methylsulfonylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63671672 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-ethoxy-4-N-(2-methylsulfonylethyl)benzene-1,4-diamine |
| SMILES | CCOc1cc(NCCS(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C11H18N2O3S/c1-3-16-11-8-9(4-5-10(11)12)13-6-7-17(2,14)15/h4-5,8,13H,3,6-7,12H2,1-2H3 |
| InChIKey | ORNFEXDWKDDLFJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|