C18H32N2O4S — CID 59549730
N-[5-(3,4-diethoxyanilino)pentyl]propane-2-sulfonamide (PubChem CID 59549730) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[5-(3,4-diethoxyanilino)pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-(3,4-diethoxyanilino)pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59549730 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-[5-(3,4-diethoxyanilino)pentyl]propane-2-sulfonamide |
| SMILES | CCOc1ccc(NCCCCCNS(=O)(=O)C(C)C)cc1OCC |
| InChI | InChI=1S/C18H32N2O4S/c1-5-23-17-11-10-16(14-18(17)24-6-2)19-12-8-7-9-13-20-25(21,22)15(3)4/h10-11,14-15,19-20H,5-9,12-13H2,1-4H3 |
| InChIKey | VVTGLZKHJWGBOH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|