C19H29N3O4S — CID 59230593
N-[5-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)amino]pentyl]propane-2-sulfonamide (PubChem CID 59230593) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[5-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)amino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)amino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230593 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[5-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)amino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)N1C(=O)c2ccc(NCCCCCNS(=O)(=O)C(C)C)cc2C1=O |
| InChI | InChI=1S/C19H29N3O4S/c1-13(2)22-18(23)16-9-8-15(12-17(16)19(22)24)20-10-6-5-7-11-21-27(25,26)14(3)4/h8-9,12-14,20-21H,5-7,10-11H2,1-4H3 |
| InChIKey | HKEFFJRTOHHULV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|