C12H12ClN3O5S — CID 100815540
2-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenoxy]acetamide (PubChem CID 100815540) has the molecular formula C12H12ClN3O5S and a molecular weight of 345.76 g/mol. Its IUPAC name is 2-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 100815540 |
| Molecular Formula | C12H12ClN3O5S |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-[2-chloro-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenoxy]acetamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(OCC(N)=O)c(Cl)c2)no1 |
| InChI | InChI=1S/C12H12ClN3O5S/c1-7-4-12(15-21-7)16-22(18,19)8-2-3-10(9(13)5-8)20-6-11(14)17/h2-5H,6H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | DZUXSOYYWAEATN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |