C17H18N2O6S — CID 45477229
4-[[(4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzoic acid (PubChem CID 45477229) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-[[(4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzoic acid.
| Compound Name | 4-[[(4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 45477229 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-[[(4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzoic acid |
| SMILES | CC(C)Oc1ccc(C(=O)NNS(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-11(2)25-14-7-3-12(4-8-14)16(20)18-19-26(23,24)15-9-5-13(6-10-15)17(21)22/h3-11,19H,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | KHGQGMZJTRMCGX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|