C22H28N2O5 — CID 8621873
3-methoxy-N'-[3-(2-methylpropoxy)benzoyl]-4-propan-2-yloxybenzohydrazide (PubChem CID 8621873) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-methoxy-N'-[3-(2-methylpropoxy)benzoyl]-4-propan-2-yloxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[3-(2-methylpropoxy)benzoyl]-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 8621873 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 3-methoxy-N'-[3-(2-methylpropoxy)benzoyl]-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(OCC(C)C)c2)ccc1OC(C)C |
| InChI | InChI=1S/C22H28N2O5/c1-14(2)13-28-18-8-6-7-16(11-18)21(25)23-24-22(26)17-9-10-19(29-15(3)4)20(12-17)27-5/h6-12,14-15H,13H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | VFRXSGMDDNRUAO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|