C21H18BrN3O5 — CID 55786874
5-bromo-N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55786874) has the molecular formula C21H18BrN3O5 and a molecular weight of 472.30 g/mol. Its IUPAC name is 5-bromo-N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55786874 |
| Molecular Formula | C21H18BrN3O5 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 5-bromo-N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2cccc(NC(=O)c3ccc(Br)o3)c2)c1 |
| InChI | InChI=1S/C21H18BrN3O5/c1-13-4-2-7-16(10-13)29-12-19(26)24-25-20(27)14-5-3-6-15(11-14)23-21(28)17-8-9-18(22)30-17/h2-11H,12H2,1H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | GIEKFMKMSAUBLB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|