C20H18BrN3O5S — CID 55771554
5-bromo-N-[3-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55771554) has the molecular formula C20H18BrN3O5S and a molecular weight of 492.35 g/mol. Its IUPAC name is 5-bromo-N-[3-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55771554 |
| Molecular Formula | C20H18BrN3O5S |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 5-bromo-N-[3-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cccc(NC(=O)c3ccc(Br)o3)c2)cc1 |
| InChI | InChI=1S/C20H18BrN3O5S/c21-18-9-8-17(29-18)20(26)24-15-3-1-2-14(12-15)19(25)23-11-10-13-4-6-16(7-5-13)30(22,27)28/h1-9,12H,10-11H2,(H,23,25)(H,24,26)(H2,22,27,28) |
| InChIKey | GETYIEWVHSJLQC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |