C19H23N3O4S — CID 1308646
3-(2-methylpropanoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 1308646) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-(2-methylpropanoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3-(2-methylpropanoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 1308646 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(2-methylpropanoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC(C)C(=O)Nc1cccc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-13(2)18(23)22-16-5-3-4-15(12-16)19(24)21-11-10-14-6-8-17(9-7-14)27(20,25)26/h3-9,12-13H,10-11H2,1-2H3,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | ZEUCBVPUCXDHKD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |