C17H14BrN3O5S2 — CID 55791536
5-bromo-N-[3-[(5-sulfamoylthiophen-2-yl)methylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55791536) has the molecular formula C17H14BrN3O5S2 and a molecular weight of 484.35 g/mol. Its IUPAC name is 5-bromo-N-[3-[(5-sulfamoylthiophen-2-yl)methylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(5-sulfamoylthiophen-2-yl)methylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55791536 |
| Molecular Formula | C17H14BrN3O5S2 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 5-bromo-N-[3-[(5-sulfamoylthiophen-2-yl)methylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cccc(NC(=O)c3ccc(Br)o3)c2)s1 |
| InChI | InChI=1S/C17H14BrN3O5S2/c18-14-6-5-13(26-14)17(23)21-11-3-1-2-10(8-11)16(22)20-9-12-4-7-15(27-12)28(19,24)25/h1-8H,9H2,(H,20,22)(H,21,23)(H2,19,24,25) |
| InChIKey | KDKIOFBHYNHTDX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |