C22H20BrN3O4 — CID 51134432
5-bromo-N-[4-[2-[2-(3-carbamoylphenyl)ethylamino]-2-oxoethyl]phenyl]furan-2-carboxamide (PubChem CID 51134432) has the molecular formula C22H20BrN3O4 and a molecular weight of 470.32 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-[2-(3-carbamoylphenyl)ethylamino]-2-oxoethyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-[2-(3-carbamoylphenyl)ethylamino]-2-oxoethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51134432 |
| Molecular Formula | C22H20BrN3O4 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 5-bromo-N-[4-[2-[2-(3-carbamoylphenyl)ethylamino]-2-oxoethyl]phenyl]furan-2-carboxamide |
| SMILES | NC(=O)c1cccc(CCNC(=O)Cc2ccc(NC(=O)c3ccc(Br)o3)cc2)c1 |
| InChI | InChI=1S/C22H20BrN3O4/c23-19-9-8-18(30-19)22(29)26-17-6-4-15(5-7-17)13-20(27)25-11-10-14-2-1-3-16(12-14)21(24)28/h1-9,12H,10-11,13H2,(H2,24,28)(H,25,27)(H,26,29) |
| InChIKey | UEUNCMDGIKISRY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |