C18H28N4O4 — CID 108517749
N'-(3,4-diethoxyphenyl)-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517749) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is N'-(3,4-diethoxyphenyl)-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-(3,4-diethoxyphenyl)-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517749 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N'-(3,4-diethoxyphenyl)-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NCCN2CCNCC2)cc1OCC |
| InChI | InChI=1S/C18H28N4O4/c1-3-25-15-6-5-14(13-16(15)26-4-2)21-18(24)17(23)20-9-12-22-10-7-19-8-11-22/h5-6,13,19H,3-4,7-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | RFVGNOLPRSMTIB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|