C15H21ClF3N3OS — CID 119445325
N-(2-piperazin-1-ylethyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide;hydrochloride (PubChem CID 119445325) has the molecular formula C15H21ClF3N3OS and a molecular weight of 383.87 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide;hydrochloride.
| Compound Name | N-(2-piperazin-1-ylethyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119445325 |
| Molecular Formula | C15H21ClF3N3OS |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide;hydrochloride |
| SMILES | Cl.O=C(CSc1cccc(C(F)(F)F)c1)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H20F3N3OS.ClH/c16-15(17,18)12-2-1-3-13(10-12)23-11-14(22)20-6-9-21-7-4-19-5-8-21;/h1-3,10,19H,4-9,11H2,(H,20,22);1H |
| InChIKey | IXEBIWZTTYRNSF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |