C18H24ClN3OS — CID 119446088
2-naphthalen-2-ylsulfanyl-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride (PubChem CID 119446088) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is 2-naphthalen-2-ylsulfanyl-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-naphthalen-2-ylsulfanyl-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119446088 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-naphthalen-2-ylsulfanyl-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CSc1ccc2ccccc2c1)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H23N3OS.ClH/c22-18(20-9-12-21-10-7-19-8-11-21)14-23-17-6-5-15-3-1-2-4-16(15)13-17;/h1-6,13,19H,7-12,14H2,(H,20,22);1H |
| InChIKey | YMFCFAFDTAQTCY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |