C20H18ClNOS — CID 2098696
N-[2-(4-chlorophenyl)ethyl]-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 2098696) has the molecular formula C20H18ClNOS and a molecular weight of 355.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2098696 |
| Molecular Formula | C20H18ClNOS |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccc2ccccc2c1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNOS/c21-18-8-5-15(6-9-18)11-12-22-20(23)14-24-19-10-7-16-3-1-2-4-17(16)13-19/h1-10,13H,11-12,14H2,(H,22,23) |
| InChIKey | MIYUDVVHPRHIHD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |