C17H18ClNOS — CID 26569763
N-[2-(3-chlorophenyl)ethyl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 26569763) has the molecular formula C17H18ClNOS and a molecular weight of 319.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 26569763 |
| Molecular Formula | C17H18ClNOS |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)NCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18ClNOS/c1-13-5-7-16(8-6-13)21-12-17(20)19-10-9-14-3-2-4-15(18)11-14/h2-8,11H,9-10,12H2,1H3,(H,19,20) |
| InChIKey | GNJFCWAEVZHVTH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |