C20H22ClNO4S — CID 8564969
[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-ethoxyphenyl)sulfanylacetate (PubChem CID 8564969) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-ethoxyphenyl)sulfanylacetate.
| Compound Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-ethoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8564969 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-ethoxyphenyl)sulfanylacetate |
| SMILES | CCOc1ccc(SCC(=O)OCC(=O)NCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO4S/c1-2-25-17-6-8-18(9-7-17)27-14-20(24)26-13-19(23)22-11-10-15-4-3-5-16(21)12-15/h3-9,12H,2,10-11,13-14H2,1H3,(H,22,23) |
| InChIKey | GVDVLIAHNZRBQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |