C20H26ClN3OS — CID 119448902
4-(phenylsulfanylmethyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119448902) has the molecular formula C20H26ClN3OS and a molecular weight of 391.97 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(phenylsulfanylmethyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119448902 |
| Molecular Formula | C20H26ClN3OS |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3OS.ClH/c24-20(22-12-15-23-13-10-21-11-14-23)18-8-6-17(7-9-18)16-25-19-4-2-1-3-5-19;/h1-9,21H,10-16H2,(H,22,24);1H |
| InChIKey | MHOVIJKKHZGEQS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |