C16H21F3N4O2 — CID 119446542
N-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 119446542) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119446542 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1C(F)(F)F)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H21F3N4O2/c17-16(18,19)13-4-2-1-3-12(13)15(25)22-11-14(24)21-7-10-23-8-5-20-6-9-23/h1-4,20H,5-11H2,(H,21,24)(H,22,25) |
| InChIKey | LENUMRXYJJSMMZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |