C15H18F3N3O2 — CID 119415885
N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 119415885) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119415885 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCCNCC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3N3O2/c16-15(17,18)12-5-2-1-4-11(12)14(23)20-10-13(22)21-8-3-6-19-7-9-21/h1-2,4-5,19H,3,6-10H2,(H,20,23) |
| InChIKey | JANLLOWNBIYIPE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |