C14H18N2O3S — CID 106443476
(2S)-2-amino-3-[(4-cyano-3-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106443476) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2S)-2-amino-3-[(4-cyano-3-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(4-cyano-3-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443476 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2S)-2-amino-3-[(4-cyano-3-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | COc1cc(CSC(C)(C)[C@@H](N)C(=O)O)ccc1C#N |
| InChI | InChI=1S/C14H18N2O3S/c1-14(2,12(16)13(17)18)20-8-9-4-5-10(7-15)11(6-9)19-3/h4-6,12H,8,16H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | MYPOUXMPQSLAPQ-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |