C13H16BrFO2 — CID 83149290
2-[(2-bromo-3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid (PubChem CID 83149290) has the molecular formula C13H16BrFO2 and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-[(2-bromo-3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[(2-bromo-3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 83149290 |
| Molecular Formula | C13H16BrFO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[(2-bromo-3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid |
| SMILES | CC(C)C(C)(Cc1cccc(F)c1Br)C(=O)O |
| InChI | InChI=1S/C13H16BrFO2/c1-8(2)13(3,12(16)17)7-9-5-4-6-10(15)11(9)14/h4-6,8H,7H2,1-3H3,(H,16,17) |
| InChIKey | ZSECNINHCCIITD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |